C21H23N3O4 — CID 55634436
(3-carbamoylphenyl)methyl 1-(phenylcarbamoyl)piperidine-3-carboxylate (PubChem CID 55634436) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 1-(phenylcarbamoyl)piperidine-3-carboxylate.
| Compound Name | (3-carbamoylphenyl)methyl 1-(phenylcarbamoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55634436 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (3-carbamoylphenyl)methyl 1-(phenylcarbamoyl)piperidine-3-carboxylate |
| SMILES | NC(=O)c1cccc(COC(=O)C2CCCN(C(=O)Nc3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H23N3O4/c22-19(25)16-7-4-6-15(12-16)14-28-20(26)17-8-5-11-24(13-17)21(27)23-18-9-2-1-3-10-18/h1-4,6-7,9-10,12,17H,5,8,11,13-14H2,(H2,22,25)(H,23,27) |
| InChIKey | PIPKUZICVWYBFE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |