C21H21F3N2O3 — CID 55320533
[3-(trifluoromethyl)phenyl]methyl 1-(phenylcarbamoyl)piperidine-4-carboxylate (PubChem CID 55320533) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 1-(phenylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 1-(phenylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55320533 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 1-(phenylcarbamoyl)piperidine-4-carboxylate |
| SMILES | O=C(OCc1cccc(C(F)(F)F)c1)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C21H21F3N2O3/c22-21(23,24)17-6-4-5-15(13-17)14-29-19(27)16-9-11-26(12-10-16)20(28)25-18-7-2-1-3-8-18/h1-8,13,16H,9-12,14H2,(H,25,28) |
| InChIKey | RFXCIVMOEYRAGM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |