C26H32N4O4 — CID 95351124
[2-(4-benzylpiperazin-1-yl)-2-oxoethyl] (3R)-1-(phenylcarbamoyl)piperidine-3-carboxylate (PubChem CID 95351124) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is [2-(4-benzylpiperazin-1-yl)-2-oxoethyl] (3R)-1-(phenylcarbamoyl)piperidine-3-carboxylate.
| Compound Name | [2-(4-benzylpiperazin-1-yl)-2-oxoethyl] (3R)-1-(phenylcarbamoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 95351124 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [2-(4-benzylpiperazin-1-yl)-2-oxoethyl] (3R)-1-(phenylcarbamoyl)piperidine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(Cc2ccccc2)CC1)[C@@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C26H32N4O4/c31-24(29-16-14-28(15-17-29)18-21-8-3-1-4-9-21)20-34-25(32)22-10-7-13-30(19-22)26(33)27-23-11-5-2-6-12-23/h1-6,8-9,11-12,22H,7,10,13-20H2,(H,27,33)/t22-/m1/s1 |
| InChIKey | ZHIYKNNZFWLMSH-JOCHJYFZSA-N |
| XLogP | 2.82 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |