C25H29N5O6 — CID 55426149
[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate (PubChem CID 55426149) has the molecular formula C25H29N5O6 and a molecular weight of 495.54 g/mol. Its IUPAC name is [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate.
| Compound Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55426149 |
| Molecular Formula | C25H29N5O6 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C25H29N5O6/c31-23(28-15-13-27(14-16-28)21-8-10-22(11-9-21)30(34)35)18-36-24(32)19-5-4-12-29(17-19)25(33)26-20-6-2-1-3-7-20/h1-3,6-11,19H,4-5,12-18H2,(H,26,33) |
| InChIKey | KQFSJPJOIJLNON-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|