C25H29N5O3 — CID 33115586
[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methanone (PubChem CID 33115586) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methanone.
| Compound Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 33115586 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methanone |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)N2CCC(c3nc4ccccc4[nH]3)CC2)CC1 |
| InChI | InChI=1S/C25H29N5O3/c1-17-8-12-28(13-9-17)23-7-6-19(30(32)33)16-20(23)25(31)29-14-10-18(11-15-29)24-26-21-4-2-3-5-22(21)27-24/h2-7,16-18H,8-15H2,1H3,(H,26,27) |
| InChIKey | PCCNSAZCOXQXRA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|