C19H15F4N3O — CID 71898934
[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 71898934) has the molecular formula C19H15F4N3O and a molecular weight of 377.34 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 71898934 |
| Molecular Formula | C19H15F4N3O |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C19H15F4N3O/c20-12-9-11(15(21)17(23)16(12)22)19(27)26-7-5-10(6-8-26)18-24-13-3-1-2-4-14(13)25-18/h1-4,9-10H,5-8H2,(H,24,25) |
| InChIKey | XYGRUWUNYJIDJJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|