C17H16BrN3OS — CID 37437294
[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(5-bromothiophen-3-yl)methanone (PubChem CID 37437294) has the molecular formula C17H16BrN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(5-bromothiophen-3-yl)methanone.
| Compound Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(5-bromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 37437294 |
| Molecular Formula | C17H16BrN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(5-bromothiophen-3-yl)methanone |
| SMILES | O=C(c1csc(Br)c1)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C17H16BrN3OS/c18-15-9-12(10-23-15)17(22)21-7-5-11(6-8-21)16-19-13-3-1-2-4-14(13)20-16/h1-4,9-11H,5-8H2,(H,19,20) |
| InChIKey | HWWONEAEULRLOH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |