C23H21N3OS — CID 46851674
[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(4-thiophen-2-ylphenyl)methanone (PubChem CID 46851674) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(4-thiophen-2-ylphenyl)methanone.
| Compound Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(4-thiophen-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 46851674 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(4-thiophen-2-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cccs2)cc1)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C23H21N3OS/c27-23(18-9-7-16(8-10-18)21-6-3-15-28-21)26-13-11-17(12-14-26)22-24-19-4-1-2-5-20(19)25-22/h1-10,15,17H,11-14H2,(H,24,25) |
| InChIKey | WWPLDGHRNSVMAF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |