C23H21N3OS — CID 87398851
2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-4-thiophen-2-ylbenzaldehyde (PubChem CID 87398851) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-4-thiophen-2-ylbenzaldehyde.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-4-thiophen-2-ylbenzaldehyde |
|---|---|
| PubChem CID | 87398851 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-4-thiophen-2-ylbenzaldehyde |
| SMILES | O=Cc1ccc(-c2cccs2)cc1N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C23H21N3OS/c27-15-18-8-7-17(22-6-3-13-28-22)14-21(18)26-11-9-16(10-12-26)23-24-19-4-1-2-5-20(19)25-23/h1-8,13-16H,9-12H2,(H,24,25) |
| InChIKey | FGTIJOYGUIILKE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|