C20H18N6O3 — CID 135620404
7-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-6-nitro-3H-quinazolin-4-one (PubChem CID 135620404) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 7-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135620404 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 7-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-6-nitro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(N3CCC(c4nc5ccccc5[nH]4)CC3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H18N6O3/c27-20-13-9-18(26(28)29)17(10-16(13)21-11-22-20)25-7-5-12(6-8-25)19-23-14-3-1-2-4-15(14)24-19/h1-4,9-12H,5-8H2,(H,23,24)(H,21,22,27) |
| InChIKey | VDSGLSKNONCGEY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|