C20H18Cl2N4O4 — CID 137263083
7-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-6-nitro-3H-quinazolin-4-one (PubChem CID 137263083) has the molecular formula C20H18Cl2N4O4 and a molecular weight of 449.29 g/mol. Its IUPAC name is 7-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137263083 |
| Molecular Formula | C20H18Cl2N4O4 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 7-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-6-nitro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(N3CCC(COc4cc(Cl)cc(Cl)c4)CC3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H18Cl2N4O4/c21-13-5-14(22)7-15(6-13)30-10-12-1-3-25(4-2-12)18-9-17-16(8-19(18)26(28)29)20(27)24-11-23-17/h5-9,11-12H,1-4,10H2,(H,23,24,27) |
| InChIKey | FMAKBTTVAMEZBL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|