C19H18N6O4 — CID 137271171
4-[4-(6-nitro-4-oxo-3H-quinazolin-7-yl)piperazin-1-yl]benzamide (PubChem CID 137271171) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is 4-[4-(6-nitro-4-oxo-3H-quinazolin-7-yl)piperazin-1-yl]benzamide.
| Compound Name | 4-[4-(6-nitro-4-oxo-3H-quinazolin-7-yl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 137271171 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-[4-(6-nitro-4-oxo-3H-quinazolin-7-yl)piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(c3cc4nc[nH]c(=O)c4cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C19H18N6O4/c20-18(26)12-1-3-13(4-2-12)23-5-7-24(8-6-23)16-10-15-14(9-17(16)25(28)29)19(27)22-11-21-15/h1-4,9-11H,5-8H2,(H2,20,26)(H,21,22,27) |
| InChIKey | LLTPHAQEWFAIQL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|