C19H19N5O6S — CID 135877311
7-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-6-nitro-3H-quinazolin-4-one (PubChem CID 135877311) has the molecular formula C19H19N5O6S and a molecular weight of 445.46 g/mol. Its IUPAC name is 7-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135877311 |
| Molecular Formula | C19H19N5O6S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 7-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-6-nitro-3H-quinazolin-4-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3cc4nc[nH]c(=O)c4cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C19H19N5O6S/c1-30-13-2-4-14(5-3-13)31(28,29)23-8-6-22(7-9-23)17-11-16-15(10-18(17)24(26)27)19(25)21-12-20-16/h2-5,10-12H,6-9H2,1H3,(H,20,21,25) |
| InChIKey | QPVHVYFMQXHPPC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 138.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|