C15H18N4O5 — CID 137267734
7-[2-(methoxymethyl)-6-methylmorpholin-4-yl]-6-nitro-3H-quinazolin-4-one (PubChem CID 137267734) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 7-[2-(methoxymethyl)-6-methylmorpholin-4-yl]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[2-(methoxymethyl)-6-methylmorpholin-4-yl]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137267734 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 7-[2-(methoxymethyl)-6-methylmorpholin-4-yl]-6-nitro-3H-quinazolin-4-one |
| SMILES | COCC1CN(c2cc3nc[nH]c(=O)c3cc2[N+](=O)[O-])CC(C)O1 |
| InChI | InChI=1S/C15H18N4O5/c1-9-5-18(6-10(24-9)7-23-2)13-4-12-11(3-14(13)19(21)22)15(20)17-8-16-12/h3-4,8-10H,5-7H2,1-2H3,(H,16,17,20) |
| InChIKey | ANNDXJLMGZAMMQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|