C21H29N5O4 — CID 137269933
7-[4-[2-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]-6-nitro-3H-quinazolin-4-one (PubChem CID 137269933) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 7-[4-[2-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[4-[2-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137269933 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 7-[4-[2-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]-6-nitro-3H-quinazolin-4-one |
| SMILES | CC1CN(CCC2CCN(c3cc4nc[nH]c(=O)c4cc3[N+](=O)[O-])CC2)CC(C)O1 |
| InChI | InChI=1S/C21H29N5O4/c1-14-11-24(12-15(2)30-14)6-3-16-4-7-25(8-5-16)19-10-18-17(9-20(19)26(28)29)21(27)23-13-22-18/h9-10,13-16H,3-8,11-12H2,1-2H3,(H,22,23,27) |
| InChIKey | DZONRXJBSWHPQT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|