C22H23N5O4 — CID 27691538
N'-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]-1H-indole-3-carbohydrazide (PubChem CID 27691538) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is N'-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]-1H-indole-3-carbohydrazide.
| Compound Name | N'-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 27691538 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N'-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]-1H-indole-3-carbohydrazide |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NNC(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H23N5O4/c1-14-8-10-26(11-9-14)20-7-6-15(27(30)31)12-17(20)21(28)24-25-22(29)18-13-23-19-5-3-2-4-16(18)19/h2-7,12-14,23H,8-11H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | VZOZZSSEHXABJR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|