C20H24N4O5 — CID 40676199
2,5-dimethyl-N'-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]furan-3-carbohydrazide (PubChem CID 40676199) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 40676199 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2,5-dimethyl-N'-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc([N+](=O)[O-])ccc2N2CCC(C)CC2)c(C)o1 |
| InChI | InChI=1S/C20H24N4O5/c1-12-6-8-23(9-7-12)18-5-4-15(24(27)28)11-17(18)20(26)22-21-19(25)16-10-13(2)29-14(16)3/h4-5,10-12H,6-9H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | OXRBDDSHOPKXDX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|