C23H23N3O5 — CID 4528151
[2-(1H-indol-3-yl)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 4528151) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 4528151 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCN(c2ccc(C(=O)OCC(=O)c3c[nH]c4ccccc34)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H23N3O5/c1-15-8-10-25(11-9-15)20-7-6-16(12-21(20)26(29)30)23(28)31-14-22(27)18-13-24-19-5-3-2-4-17(18)19/h2-7,12-13,15,24H,8-11,14H2,1H3 |
| InChIKey | OCLYPNUKIXVELW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|