C24H29N3O6 — CID 41407843
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 41407843) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 41407843 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)c2ccc(N3CCC(C)CC3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H29N3O6/c1-17-10-13-26(14-11-17)21-8-5-19(15-22(21)27(30)31)24(29)33-16-23(28)25-12-9-18-3-6-20(32-2)7-4-18/h3-8,15,17H,9-14,16H2,1-2H3,(H,25,28) |
| InChIKey | UVSDMPRUYYVONB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|