C21H22N4O3S — CID 34254494
N-(1,3-benzothiazol-2-yl)-N-methyl-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide (PubChem CID 34254494) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-methyl-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-methyl-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 34254494 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-methyl-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)N(C)c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H22N4O3S/c1-14-9-11-24(12-10-14)18-8-7-15(25(27)28)13-16(18)20(26)23(2)21-22-17-5-3-4-6-19(17)29-21/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | SFQIDWPGPNJUQT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|