C24H30N4O4 — CID 27788198
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide (PubChem CID 27788198) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 27788198 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)c1cc([N+](=O)[O-])ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C24H30N4O4/c1-16-10-12-27(13-11-16)21-9-8-19(28(31)32)14-20(21)24(30)26(4)15-22(29)25-23-17(2)6-5-7-18(23)3/h5-9,14,16H,10-13,15H2,1-4H3,(H,25,29) |
| InChIKey | RIEMVHAQKQOEAT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|