C23H28N4O4 — CID 9431366
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 9431366) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9431366 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H28N4O4/c1-16-7-6-8-17(2)22(16)24-21(28)15-25(3)23(29)18-11-13-26(14-12-18)19-9-4-5-10-20(19)27(30)31/h4-10,18H,11-15H2,1-3H3,(H,24,28) |
| InChIKey | OBTHXTFBSJVOQI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|