C26H33N5O5 — CID 55328483
N-methyl-2-(4-methylpiperidin-1-yl)-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-5-nitrobenzamide (PubChem CID 55328483) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-methyl-2-(4-methylpiperidin-1-yl)-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-5-nitrobenzamide.
| Compound Name | N-methyl-2-(4-methylpiperidin-1-yl)-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 55328483 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-methyl-2-(4-methylpiperidin-1-yl)-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-5-nitrobenzamide |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C26H33N5O5/c1-19-9-11-30(12-10-19)24-8-7-22(31(34)35)17-23(24)26(33)28(2)18-25(32)27-20-3-5-21(6-4-20)29-13-15-36-16-14-29/h3-8,17,19H,9-16,18H2,1-2H3,(H,27,32) |
| InChIKey | WVVAICRQBIRQDQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|