C18H17N5O5 — CID 55569469
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(methylamino)-5-nitrobenzoate (PubChem CID 55569469) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(methylamino)-5-nitrobenzoate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(methylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 55569469 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(methylamino)-5-nitrobenzoate |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)OCCCc1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C18H17N5O5/c1-19-15-7-6-13(23(25)26)10-14(15)18(24)27-9-3-5-16-21-17(22-28-16)12-4-2-8-20-11-12/h2,4,6-8,10-11,19H,3,5,9H2,1H3 |
| InChIKey | MMRVCSDKLZTVKM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 133.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|