C17H14ClN3O4 — CID 55569305
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 4-chloro-2-hydroxybenzoate (PubChem CID 55569305) has the molecular formula C17H14ClN3O4 and a molecular weight of 359.77 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 4-chloro-2-hydroxybenzoate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 55569305 |
| Molecular Formula | C17H14ClN3O4 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 4-chloro-2-hydroxybenzoate |
| SMILES | O=C(OCCCc1nc(-c2cccnc2)no1)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C17H14ClN3O4/c18-12-5-6-13(14(22)9-12)17(23)24-8-2-4-15-20-16(21-25-15)11-3-1-7-19-10-11/h1,3,5-7,9-10,22H,2,4,8H2 |
| InChIKey | VVUGYUXGHJLKPY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|