C15H11ClN4O5S — CID 55492427
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 2-chloro-5-sulfamoylbenzoate (PubChem CID 55492427) has the molecular formula C15H11ClN4O5S and a molecular weight of 394.80 g/mol. Its IUPAC name is (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 2-chloro-5-sulfamoylbenzoate.
| Compound Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55492427 |
| Molecular Formula | C15H11ClN4O5S |
| Molecular Weight | 394.80 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 2-chloro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(C(=O)OCc2nc(-c3cccnc3)no2)c1 |
| InChI | InChI=1S/C15H11ClN4O5S/c16-12-4-3-10(26(17,22)23)6-11(12)15(21)24-8-13-19-14(20-25-13)9-2-1-5-18-7-9/h1-7H,8H2,(H2,17,22,23) |
| InChIKey | NYPBVGKWCYJDEI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 138.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.80 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |