C15H12N4O5S — CID 55499436
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-sulfamoylbenzoate (PubChem CID 55499436) has the molecular formula C15H12N4O5S and a molecular weight of 360.35 g/mol. Its IUPAC name is (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-sulfamoylbenzoate.
| Compound Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55499436 |
| Molecular Formula | C15H12N4O5S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)OCc2nc(-c3cccnc3)no2)cc1 |
| InChI | InChI=1S/C15H12N4O5S/c16-25(21,22)12-5-3-10(4-6-12)15(20)23-9-13-18-14(19-24-13)11-2-1-7-17-8-11/h1-8H,9H2,(H2,16,21,22) |
| InChIKey | PKTRAUJHQIUNPW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 138.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |