C22H16N4O8S — CID 55486745
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate (PubChem CID 55486745) has the molecular formula C22H16N4O8S and a molecular weight of 496.46 g/mol. Its IUPAC name is (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate.
| Compound Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 55486745 |
| Molecular Formula | C22H16N4O8S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Oc1ccc(C(=O)OCc2nc(-c3cccnc3)no2)cc1 |
| InChI | InChI=1S/C22H16N4O8S/c1-14-4-7-17(26(28)29)11-19(14)35(30,31)34-18-8-5-15(6-9-18)22(27)32-13-20-24-21(25-33-20)16-3-2-10-23-12-16/h2-12H,13H2,1H3 |
| InChIKey | JLRANTFWKMXVMS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 164.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|