C19H18N4O6 — CID 135815739
(4-oxo-3H-quinazolin-2-yl)methyl 2-(2-methoxyethylamino)-5-nitrobenzoate (PubChem CID 135815739) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is (4-oxo-3H-quinazolin-2-yl)methyl 2-(2-methoxyethylamino)-5-nitrobenzoate.
| Compound Name | (4-oxo-3H-quinazolin-2-yl)methyl 2-(2-methoxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 135815739 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (4-oxo-3H-quinazolin-2-yl)methyl 2-(2-methoxyethylamino)-5-nitrobenzoate |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(=O)OCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H18N4O6/c1-28-9-8-20-15-7-6-12(23(26)27)10-14(15)19(25)29-11-17-21-16-5-3-2-4-13(16)18(24)22-17/h2-7,10,20H,8-9,11H2,1H3,(H,21,22,24) |
| InChIKey | LCMKCJHURWMFTC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|