C23H16Cl2N4O5 — CID 135730058
(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate (PubChem CID 135730058) has the molecular formula C23H16Cl2N4O5 and a molecular weight of 499.31 g/mol. Its IUPAC name is (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate.
| Compound Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 135730058 |
| Molecular Formula | C23H16Cl2N4O5 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate |
| SMILES | O=C(OCc1nc2cc(Cl)ccc2c(=O)[nH]1)c1cc([N+](=O)[O-])ccc1NCc1ccccc1Cl |
| InChI | InChI=1S/C23H16Cl2N4O5/c24-14-5-7-16-20(9-14)27-21(28-22(16)30)12-34-23(31)17-10-15(29(32)33)6-8-19(17)26-11-13-3-1-2-4-18(13)25/h1-10,26H,11-12H2,(H,27,28,30) |
| InChIKey | ZXAWPUBREXBUKQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|