C20H17ClN4O5S — CID 35345181
(2-acetamido-1,3-thiazol-4-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate (PubChem CID 35345181) has the molecular formula C20H17ClN4O5S and a molecular weight of 460.90 g/mol. Its IUPAC name is (2-acetamido-1,3-thiazol-4-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate.
| Compound Name | (2-acetamido-1,3-thiazol-4-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 35345181 |
| Molecular Formula | C20H17ClN4O5S |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | (2-acetamido-1,3-thiazol-4-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate |
| SMILES | CC(=O)Nc1nc(COC(=O)c2cc([N+](=O)[O-])ccc2NCc2ccccc2Cl)cs1 |
| InChI | InChI=1S/C20H17ClN4O5S/c1-12(26)23-20-24-14(11-31-20)10-30-19(27)16-8-15(25(28)29)6-7-18(16)22-9-13-4-2-3-5-17(13)21/h2-8,11,22H,9-10H2,1H3,(H,23,24,26) |
| InChIKey | QNJMOXOCCDATCJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|