C20H18ClN3O5 — CID 7890357
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate (PubChem CID 7890357) has the molecular formula C20H18ClN3O5 and a molecular weight of 415.83 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 7890357 |
| Molecular Formula | C20H18ClN3O5 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoate |
| SMILES | Cc1noc(C)c1COC(=O)c1cc([N+](=O)[O-])ccc1NCc1ccccc1Cl |
| InChI | InChI=1S/C20H18ClN3O5/c1-12-17(13(2)29-23-12)11-28-20(25)16-9-15(24(26)27)7-8-19(16)22-10-14-5-3-4-6-18(14)21/h3-9,22H,10-11H2,1-2H3 |
| InChIKey | TYBAUKYVLIOCCJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|