C18H20ClN3O7S — CID 3983157
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 1-(2-chloro-5-nitrophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 3983157) has the molecular formula C18H20ClN3O7S and a molecular weight of 457.89 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 1-(2-chloro-5-nitrophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 1-(2-chloro-5-nitrophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 3983157 |
| Molecular Formula | C18H20ClN3O7S |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 1-(2-chloro-5-nitrophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1noc(C)c1COC(=O)C1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)CC1 |
| InChI | InChI=1S/C18H20ClN3O7S/c1-11-15(12(2)29-20-11)10-28-18(23)13-5-7-21(8-6-13)30(26,27)17-9-14(22(24)25)3-4-16(17)19/h3-4,9,13H,5-8,10H2,1-2H3 |
| InChIKey | BFPPHVPBKQVWOX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 132.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|