C22H21N3O7 — CID 55310147
[2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate (PubChem CID 55310147) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate.
| Compound Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 55310147 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)c1ccccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C22H21N3O7/c1-13-8-9-16(25(28)29)10-19(13)23-21(26)12-31-22(27)17-6-4-5-7-20(17)30-11-18-14(2)24-32-15(18)3/h4-10H,11-12H2,1-3H3,(H,23,26) |
| InChIKey | SYXIIPKTMQOZLA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|