C24H21N3O7 — CID 55378683
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate (PubChem CID 55378683) has the molecular formula C24H21N3O7 and a molecular weight of 463.45 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 55378683 |
| Molecular Formula | C24H21N3O7 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
| SMILES | Cc1noc(C)c1COc1ccccc1C(=O)OCC(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C24H21N3O7/c1-13-19(14(2)34-26-13)11-32-20-7-5-4-6-17(20)24(31)33-12-21(28)25-15-8-9-16-18(10-15)23(30)27(3)22(16)29/h4-10H,11-12H2,1-3H3,(H,25,28) |
| InChIKey | CFGGKAZTRBIWMR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|