C22H18N4O7 — CID 55497663
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate (PubChem CID 55497663) has the molecular formula C22H18N4O7 and a molecular weight of 450.41 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 55497663 |
| Molecular Formula | C22H18N4O7 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate |
| SMILES | Cc1nc(COc2ccc(C(=O)OCC(=O)Nc3ccc4c(c3)C(=O)N(C)C4=O)cc2)no1 |
| InChI | InChI=1S/C22H18N4O7/c1-12-23-18(25-33-12)10-31-15-6-3-13(4-7-15)22(30)32-11-19(27)24-14-5-8-16-17(9-14)21(29)26(2)20(16)28/h3-9H,10-11H2,1-2H3,(H,24,27) |
| InChIKey | MJKFYQUYSCKNSS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|