C22H17N3O6S — CID 35493074
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 35493074) has the molecular formula C22H17N3O6S and a molecular weight of 451.46 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 35493074 |
| Molecular Formula | C22H17N3O6S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(-c2nc(C(=O)OCC(=O)Nc3ccc4c(c3)C(=O)N(C)C4=O)cs2)cc1 |
| InChI | InChI=1S/C22H17N3O6S/c1-25-20(27)15-8-5-13(9-16(15)21(25)28)23-18(26)10-31-22(29)17-11-32-19(24-17)12-3-6-14(30-2)7-4-12/h3-9,11H,10H2,1-2H3,(H,23,26) |
| InChIKey | TZWOFZRCEVXKOF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|