C21H20N2O8 — CID 32690095
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3,4,5-trimethoxybenzoate (PubChem CID 32690095) has the molecular formula C21H20N2O8 and a molecular weight of 428.40 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 32690095 |
| Molecular Formula | C21H20N2O8 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H20N2O8/c1-23-19(25)13-6-5-12(9-14(13)20(23)26)22-17(24)10-31-21(27)11-7-15(28-2)18(30-4)16(8-11)29-3/h5-9H,10H2,1-4H3,(H,22,24) |
| InChIKey | SPXSFNJTMPPARV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|