C23H22N2O8 — CID 16510628
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 16510628) has the molecular formula C23H22N2O8 and a molecular weight of 454.44 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16510628 |
| Molecular Formula | C23H22N2O8 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCC(=O)Nc3cc(OC)c(OC)c(OC)c3)cc2C1=O |
| InChI | InChI=1S/C23H22N2O8/c1-5-8-25-21(27)15-7-6-13(9-16(15)22(25)28)23(29)33-12-19(26)24-14-10-17(30-2)20(32-4)18(11-14)31-3/h5-7,9-11H,1,8,12H2,2-4H3,(H,24,26) |
| InChIKey | NCDNUJXANUCDCL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|