C20H14Cl2N2O5 — CID 16510733
[2-(3,4-dichloroanilino)-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 16510733) has the molecular formula C20H14Cl2N2O5 and a molecular weight of 433.25 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16510733 |
| Molecular Formula | C20H14Cl2N2O5 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCC(=O)Nc3ccc(Cl)c(Cl)c3)cc2C1=O |
| InChI | InChI=1S/C20H14Cl2N2O5/c1-2-7-24-18(26)13-5-3-11(8-14(13)19(24)27)20(28)29-10-17(25)23-12-4-6-15(21)16(22)9-12/h2-6,8-9H,1,7,10H2,(H,23,25) |
| InChIKey | BEQWCEYLBDVQOJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|