C24H20ClN3O5 — CID 24671628
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 24671628) has the molecular formula C24H20ClN3O5 and a molecular weight of 465.89 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 24671628 |
| Molecular Formula | C24H20ClN3O5 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O5/c25-20-11-16(8-6-15(20)12-26)27-21(29)13-33-24(32)14-7-9-18-19(10-14)23(31)28(22(18)30)17-4-2-1-3-5-17/h6-11,17H,1-5,13H2,(H,27,29) |
| InChIKey | UMMBNYDQKWAXEX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|