C24H22ClN3O6 — CID 41179508
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 41179508) has the molecular formula C24H22ClN3O6 and a molecular weight of 483.91 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 41179508 |
| Molecular Formula | C24H22ClN3O6 |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClN3O6/c25-16-9-6-14(7-10-16)21(30)27-26-20(29)13-34-24(33)15-8-11-18-19(12-15)23(32)28(22(18)31)17-4-2-1-3-5-17/h6-12,17H,1-5,13H2,(H,26,29)(H,27,30) |
| InChIKey | YVTLLOPLHTZQOY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|