C25H25N3O7S — CID 16510745
[2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 16510745) has the molecular formula C25H25N3O7S and a molecular weight of 511.56 g/mol. Its IUPAC name is [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16510745 |
| Molecular Formula | C25H25N3O7S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCC(=O)Nc3cccc(S(=O)(=O)N4CCCCC4)c3)cc2C1=O |
| InChI | InChI=1S/C25H25N3O7S/c1-2-11-28-23(30)20-10-9-17(14-21(20)24(28)31)25(32)35-16-22(29)26-18-7-6-8-19(15-18)36(33,34)27-12-4-3-5-13-27/h2,6-10,14-15H,1,3-5,11-13,16H2,(H,26,29) |
| InChIKey | ZEJXFDOLCADHSR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|