C24H25N3O8 — CID 55378555
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4,5-dimethoxy-2-(2-methylpropanoylamino)benzoate (PubChem CID 55378555) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4,5-dimethoxy-2-(2-methylpropanoylamino)benzoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4,5-dimethoxy-2-(2-methylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 55378555 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4,5-dimethoxy-2-(2-methylpropanoylamino)benzoate |
| SMILES | COc1cc(NC(=O)C(C)C)c(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)cc1OC |
| InChI | InChI=1S/C24H25N3O8/c1-12(2)21(29)26-17-10-19(34-5)18(33-4)9-16(17)24(32)35-11-20(28)25-13-6-7-14-15(8-13)23(31)27(3)22(14)30/h6-10,12H,11H2,1-5H3,(H,25,28)(H,26,29) |
| InChIKey | QEFQSWHKLCNFNH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|