C19H15ClN2O5S — CID 32689875
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate (PubChem CID 32689875) has the molecular formula C19H15ClN2O5S and a molecular weight of 418.86 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 32689875 |
| Molecular Formula | C19H15ClN2O5S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate |
| SMILES | CSc1ccc(Cl)c(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)c1 |
| InChI | InChI=1S/C19H15ClN2O5S/c1-22-17(24)12-5-3-10(7-13(12)18(22)25)21-16(23)9-27-19(26)14-8-11(28-2)4-6-15(14)20/h3-8H,9H2,1-2H3,(H,21,23) |
| InChIKey | QGRNLWXPLMTUDT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|