C21H23ClN2O4S — CID 26165035
[2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate (PubChem CID 26165035) has the molecular formula C21H23ClN2O4S and a molecular weight of 434.95 g/mol. Its IUPAC name is [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate.
| Compound Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 26165035 |
| Molecular Formula | C21H23ClN2O4S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate |
| SMILES | CSc1ccc(Cl)c(C(=O)OCC(=O)Nc2ccc(CN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C21H23ClN2O4S/c1-29-17-6-7-19(22)18(12-17)21(26)28-14-20(25)23-16-4-2-15(3-5-16)13-24-8-10-27-11-9-24/h2-7,12H,8-11,13-14H2,1H3,(H,23,25) |
| InChIKey | LJYHGSUHNYCVJX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |