C26H26N2O4 — CID 55530061
[2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-phenylbenzoate (PubChem CID 55530061) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-phenylbenzoate.
| Compound Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 55530061 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-phenylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1-c1ccccc1)Nc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H26N2O4/c29-25(27-22-12-10-20(11-13-22)18-28-14-16-31-17-15-28)19-32-26(30)24-9-5-4-8-23(24)21-6-2-1-3-7-21/h1-13H,14-19H2,(H,27,29) |
| InChIKey | FUUOOLUYTHBIFX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |