C28H30N2O6 — CID 24518315
[2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-(4-phenylmethoxyphenoxy)acetate (PubChem CID 24518315) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-(4-phenylmethoxyphenoxy)acetate.
| Compound Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-(4-phenylmethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 24518315 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 2-(4-phenylmethoxyphenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccc(OCc2ccccc2)cc1)Nc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C28H30N2O6/c31-27(29-24-8-6-22(7-9-24)18-30-14-16-33-17-15-30)20-36-28(32)21-35-26-12-10-25(11-13-26)34-19-23-4-2-1-3-5-23/h1-13H,14-21H2,(H,29,31) |
| InChIKey | AVHRVADYJMAZJQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |