C27H30N2O4 — CID 55970132
N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2-(4-phenylmethoxyphenoxy)acetamide (PubChem CID 55970132) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2-(4-phenylmethoxyphenoxy)acetamide.
| Compound Name | N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2-(4-phenylmethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 55970132 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2-(4-phenylmethoxyphenoxy)acetamide |
| SMILES | O=C(COc1ccc(OCc2ccccc2)cc1)NCc1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C27H30N2O4/c30-27(28-18-23-7-4-8-24(17-23)19-29-13-15-31-16-14-29)21-33-26-11-9-25(10-12-26)32-20-22-5-2-1-3-6-22/h1-12,17H,13-16,18-21H2,(H,28,30) |
| InChIKey | BQRALDSERKEXLU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |