C20H23IN2O3 — CID 55969614
2-(4-iodophenoxy)-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]acetamide (PubChem CID 55969614) has the molecular formula C20H23IN2O3 and a molecular weight of 466.32 g/mol. Its IUPAC name is 2-(4-iodophenoxy)-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-iodophenoxy)-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55969614 |
| Molecular Formula | C20H23IN2O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 2-(4-iodophenoxy)-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]acetamide |
| SMILES | O=C(COc1ccc(I)cc1)NCc1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C20H23IN2O3/c21-18-4-6-19(7-5-18)26-15-20(24)22-13-16-2-1-3-17(12-16)14-23-8-10-25-11-9-23/h1-7,12H,8-11,13-15H2,(H,22,24) |
| InChIKey | GBIRORRHKLCANS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|